C20H36N4O10P2 — CID 156631192
2,5-bis(2-diethoxyphosphorylethoxy)benzene-1,4-dicarbohydrazide (PubChem CID 156631192) has the molecular formula C20H36N4O10P2 and a molecular weight of 554.47 g/mol. Its IUPAC name is 2,5-bis(2-diethoxyphosphorylethoxy)benzene-1,4-dicarbohydrazide.
| Compound Name | 2,5-bis(2-diethoxyphosphorylethoxy)benzene-1,4-dicarbohydrazide |
|---|---|
| PubChem CID | 156631192 |
| Molecular Formula | C20H36N4O10P2 |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 2,5-bis(2-diethoxyphosphorylethoxy)benzene-1,4-dicarbohydrazide |
| SMILES | CCOP(=O)(CCOc1cc(C(=O)NN)c(OCCP(=O)(OCC)OCC)cc1C(=O)NN)OCC |
| InChI | InChI=1S/C20H36N4O10P2/c1-5-31-35(27,32-6-2)11-9-29-17-13-16(20(26)24-22)18(14-15(17)19(25)23-21)30-10-12-36(28,33-7-3)34-8-4/h13-14H,5-12,21-22H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | QUUUHUDOVVPMFJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 199.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|