C26H37IN6O3 — CID 176550236
N-[2-[[1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]triazol-4-yl]methoxy]ethyl]-N-methyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline iodide (PubChem CID 176550236) has the molecular formula C26H37IN6O3 and a molecular weight of 608.53 g/mol. Its IUPAC name is N-[2-[[1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]triazol-4-yl]methoxy]ethyl]-N-methyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline iodide.
| Compound Name | N-[2-[[1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]triazol-4-yl]methoxy]ethyl]-N-methyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline iodide |
|---|---|
| PubChem CID | 176550236 |
| Molecular Formula | C26H37IN6O3 |
| Molecular Weight | 608.53 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | N-[2-[[1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]triazol-4-yl]methoxy]ethyl]-N-methyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline iodide |
| SMILES | CN(CCOCc1cn(CCOCCOCCN)nn1)c1ccc(/C=C/c2cc[n+](C)cc2)cc1.[I-] |
| InChI | InChI=1S/C26H37N6O3.HI/c1-30-12-9-24(10-13-30)4-3-23-5-7-26(8-6-23)31(2)14-17-35-22-25-21-32(29-28-25)15-18-34-20-19-33-16-11-27;/h3-10,12-13,21H,11,14-20,22,27H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | HWHRSDAXCJPREH-UHFFFAOYSA-M |
| XLogP | -1.08 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.53 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|