C18H21N2O3+ — CID 176552287
(2,5-dihydroxy-4-propan-2-ylphenyl)-(5-methyl-1,3-dihydropyrrolo[3,4-c]pyridin-5-ium-2-yl)methanone (PubChem CID 176552287) has the molecular formula C18H21N2O3+ and a molecular weight of 313.38 g/mol. Its IUPAC name is (2,5-dihydroxy-4-propan-2-ylphenyl)-(5-methyl-1,3-dihydropyrrolo[3,4-c]pyridin-5-ium-2-yl)methanone.
| Compound Name | (2,5-dihydroxy-4-propan-2-ylphenyl)-(5-methyl-1,3-dihydropyrrolo[3,4-c]pyridin-5-ium-2-yl)methanone |
|---|---|
| PubChem CID | 176552287 |
| Molecular Formula | C18H21N2O3+ |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (2,5-dihydroxy-4-propan-2-ylphenyl)-(5-methyl-1,3-dihydropyrrolo[3,4-c]pyridin-5-ium-2-yl)methanone |
| SMILES | CC(C)c1cc(O)c(C(=O)N2Cc3cc[n+](C)cc3C2)cc1O |
| InChI | InChI=1S/C18H20N2O3/c1-11(2)14-6-17(22)15(7-16(14)21)18(23)20-9-12-4-5-19(3)8-13(12)10-20/h4-8,11H,9-10H2,1-3H3,(H-,21,22,23)/p+1 |
| InChIKey | PVXBSYLHSGBVMK-UHFFFAOYSA-O |
| XLogP | 2.20 |
| TPSA | 64.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|