C22H25N3O6 — CID 162652149
N-[2-(2,4-dihydroxy-5-propan-2-ylbenzoyl)-1,3-dihydroisoindol-5-yl]-N'-hydroxybutanediamide (PubChem CID 162652149) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is N-[2-(2,4-dihydroxy-5-propan-2-ylbenzoyl)-1,3-dihydroisoindol-5-yl]-N'-hydroxybutanediamide.
| Compound Name | N-[2-(2,4-dihydroxy-5-propan-2-ylbenzoyl)-1,3-dihydroisoindol-5-yl]-N'-hydroxybutanediamide |
|---|---|
| PubChem CID | 162652149 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-[2-(2,4-dihydroxy-5-propan-2-ylbenzoyl)-1,3-dihydroisoindol-5-yl]-N'-hydroxybutanediamide |
| SMILES | CC(C)c1cc(C(=O)N2Cc3ccc(NC(=O)CCC(=O)NO)cc3C2)c(O)cc1O |
| InChI | InChI=1S/C22H25N3O6/c1-12(2)16-8-17(19(27)9-18(16)26)22(30)25-10-13-3-4-15(7-14(13)11-25)23-20(28)5-6-21(29)24-31/h3-4,7-9,12,26-27,31H,5-6,10-11H2,1-2H3,(H,23,28)(H,24,29) |
| InChIKey | HWHOXINBNOJDGW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|