C15H23F3N2 — CID 176552649
ethane;3-(4-ethylpiperidin-1-yl)-2-(trifluoromethyl)pyridine (PubChem CID 176552649) has the molecular formula C15H23F3N2 and a molecular weight of 288.36 g/mol. Its IUPAC name is ethane;3-(4-ethylpiperidin-1-yl)-2-(trifluoromethyl)pyridine.
| Compound Name | ethane;3-(4-ethylpiperidin-1-yl)-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 176552649 |
| Molecular Formula | C15H23F3N2 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | ethane;3-(4-ethylpiperidin-1-yl)-2-(trifluoromethyl)pyridine |
| SMILES | CC.CCC1CCN(c2cccnc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H17F3N2.C2H6/c1-2-10-5-8-18(9-6-10)11-4-3-7-17-12(11)13(14,15)16;1-2/h3-4,7,10H,2,5-6,8-9H2,1H3;1-2H3 |
| InChIKey | IXEZECMHENFKAB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |