C12H17ClN2 — CID 176552939
4-chloro-3-(4-ethylpiperidin-1-yl)pyridine (PubChem CID 176552939) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is 4-chloro-3-(4-ethylpiperidin-1-yl)pyridine.
| Compound Name | 4-chloro-3-(4-ethylpiperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 176552939 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 4-chloro-3-(4-ethylpiperidin-1-yl)pyridine |
| SMILES | CCC1CCN(c2cnccc2Cl)CC1 |
| InChI | InChI=1S/C12H17ClN2/c1-2-10-4-7-15(8-5-10)12-9-14-6-3-11(12)13/h3,6,9-10H,2,4-5,7-8H2,1H3 |
| InChIKey | SUOYHEVKIVJEQW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |