C15H20F2 — CID 176552656
1,3-difluoro-2-(4-propan-2-ylcyclohexyl)benzene (PubChem CID 176552656) has the molecular formula C15H20F2 and a molecular weight of 238.32 g/mol. Its IUPAC name is 1,3-difluoro-2-(4-propan-2-ylcyclohexyl)benzene.
| Compound Name | 1,3-difluoro-2-(4-propan-2-ylcyclohexyl)benzene |
|---|---|
| PubChem CID | 176552656 |
| Molecular Formula | C15H20F2 |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1,3-difluoro-2-(4-propan-2-ylcyclohexyl)benzene |
| SMILES | CC(C)C1CCC(c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C15H20F2/c1-10(2)11-6-8-12(9-7-11)15-13(16)4-3-5-14(15)17/h3-5,10-12H,6-9H2,1-2H3 |
| InChIKey | DDURWGXUCYCAPR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |