C30H39ClN6O2 — CID 176554176
N-[4-[(3-chloro-4-cyanophenyl)methylamino]cyclohexyl]-6-[4-(6-oxohexyl)piperidin-1-yl]pyridazine-3-carboxamide (PubChem CID 176554176) has the molecular formula C30H39ClN6O2 and a molecular weight of 551.14 g/mol. Its IUPAC name is N-[4-[(3-chloro-4-cyanophenyl)methylamino]cyclohexyl]-6-[4-(6-oxohexyl)piperidin-1-yl]pyridazine-3-carboxamide.
| Compound Name | N-[4-[(3-chloro-4-cyanophenyl)methylamino]cyclohexyl]-6-[4-(6-oxohexyl)piperidin-1-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 176554176 |
| Molecular Formula | C30H39ClN6O2 |
| Molecular Weight | 551.14 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | N-[4-[(3-chloro-4-cyanophenyl)methylamino]cyclohexyl]-6-[4-(6-oxohexyl)piperidin-1-yl]pyridazine-3-carboxamide |
| SMILES | N#Cc1ccc(CNC2CCC(NC(=O)c3ccc(N4CCC(CCCCCC=O)CC4)nn3)CC2)cc1Cl |
| InChI | InChI=1S/C30H39ClN6O2/c31-27-19-23(6-7-24(27)20-32)21-33-25-8-10-26(11-9-25)34-30(39)28-12-13-29(36-35-28)37-16-14-22(15-17-37)5-3-1-2-4-18-38/h6-7,12-13,18-19,22,25-26,33H,1-5,8-11,14-17,21H2,(H,34,39) |
| InChIKey | GNVKLPWYAYOBLD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.14 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|