About 6-(4-dodecan-6-ylpiperazin-1-yl)hexyl nonyl hydrogen phosphate
6-(4-dodecan-6-ylpiperazin-1-yl)hexyl nonyl hydrogen phosphate (PubChem CID 176554769) has the molecular formula C31H65N2O4P
and a molecular weight of 560.85 g/mol. Its IUPAC name is 6-(4-dodecan-6-ylpiperazin-1-yl)hexyl nonyl hydrogen phosphate.
Molecular Properties
| Compound Name | 6-(4-dodecan-6-ylpiperazin-1-yl)hexyl nonyl hydrogen phosphate |
| PubChem CID | 176554769 |
| Molecular Formula | C31H65N2O4P |
| Molecular Weight | 560.85 g/mol |
| Exact Mass | 560.47 |
| IUPAC Name | 6-(4-dodecan-6-ylpiperazin-1-yl)hexyl nonyl hydrogen phosphate |
| SMILES | CCCCCCCCCOP(=O)(O)OCCCCCCN1CCN(C(CCCCC)CCCCCC)CC1 |
| InChI | InChI=1S/C31H65N2O4P/c1-4-7-10-12-13-15-20-29-36-38(34,35)37-30-21-16-14-19-24-32-25-27-33(28-26-32)31(22-17-9-6-3)23-18-11-8-5-2/h31H,4-30H2,1-3H3,(H,34,35) |
| InChIKey | QHLMINSHSRUSFU-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 560.85 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-dodecan-6-ylpiperazin-1-yl)hexyl nonyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-dodecan-6-ylpiperazin-1-yl)hexyl nonyl hydrogen phosphate?
The IUPAC name of 6-(4-dodecan-6-ylpiperazin-1-yl)hexyl nonyl hydrogen phosphate (CID 176554769) is 6-(4-dodecan-6-ylpiperazin-1-yl)hexyl nonyl hydrogen phosphate.
What is the SMILES notation for 6-(4-dodecan-6-ylpiperazin-1-yl)hexyl nonyl hydrogen phosphate?
The canonical SMILES for 6-(4-dodecan-6-ylpiperazin-1-yl)hexyl nonyl hydrogen phosphate is CCCCCCCCCOP(=O)(O)OCCCCCCN1CCN(C(CCCCC)CCCCCC)CC1.
What is the InChIKey of 6-(4-dodecan-6-ylpiperazin-1-yl)hexyl nonyl hydrogen phosphate?
The InChIKey is QHLMINSHSRUSFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H65N2O4P/c1-4-7-10-12-13-15-20-29-36-38(34,35)37-30-21-16-14-19-24-32-25-27-33(28-26-32)31(22-17-9-6-3)23-18-11-8-5-2/h31H,4-30H2,1-3H3,(H,34,35).
What are the key properties of 6-(4-dodecan-6-ylpiperazin-1-yl)hexyl nonyl hydrogen phosphate?
6-(4-dodecan-6-ylpiperazin-1-yl)hexyl nonyl hydrogen phosphate has a molecular weight of 560.85 g/mol, XLogP of 8.97, 27 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-dodecan-6-ylpiperazin-1-yl)hexyl nonyl hydrogen phosphate is sourced from PubChem (CID 176554769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).