C24H20N4O3S — CID 176555687
N-[5-[3-[(3E)-hexa-1,3,5-trien-3-yl]oxyprop-1-ynyl]-1,3,4-thiadiazol-2-yl]-3-(2-methoxyphenyl)pyridine-4-carboxamide (PubChem CID 176555687) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is N-[5-[3-[(3E)-hexa-1,3,5-trien-3-yl]oxyprop-1-ynyl]-1,3,4-thiadiazol-2-yl]-3-(2-methoxyphenyl)pyridine-4-carboxamide.
| Compound Name | N-[5-[3-[(3E)-hexa-1,3,5-trien-3-yl]oxyprop-1-ynyl]-1,3,4-thiadiazol-2-yl]-3-(2-methoxyphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 176555687 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-[5-[3-[(3E)-hexa-1,3,5-trien-3-yl]oxyprop-1-ynyl]-1,3,4-thiadiazol-2-yl]-3-(2-methoxyphenyl)pyridine-4-carboxamide |
| SMILES | C=C/C=C(\C=C)OCC#Cc1nnc(NC(=O)c2ccncc2-c2ccccc2OC)s1 |
| InChI | InChI=1S/C24H20N4O3S/c1-4-9-17(5-2)31-15-8-12-22-27-28-24(32-22)26-23(29)19-13-14-25-16-20(19)18-10-6-7-11-21(18)30-3/h4-7,9-11,13-14,16H,1-2,15H2,3H3,(H,26,28,29)/b17-9+ |
| InChIKey | KXETZRRGXZTAMF-RQZCQDPDSA-N |
| XLogP | 4.49 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|