C15H20FN7O — CID 176556477
2-[(2R)-2-(2-fluoroethoxymethyl)-4-(5-methylpyrimidin-2-yl)piperazin-1-yl]-1,3,5-triazine (PubChem CID 176556477) has the molecular formula C15H20FN7O and a molecular weight of 333.37 g/mol. Its IUPAC name is 2-[(2R)-2-(2-fluoroethoxymethyl)-4-(5-methylpyrimidin-2-yl)piperazin-1-yl]-1,3,5-triazine.
| Compound Name | 2-[(2R)-2-(2-fluoroethoxymethyl)-4-(5-methylpyrimidin-2-yl)piperazin-1-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 176556477 |
| Molecular Formula | C15H20FN7O |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-[(2R)-2-(2-fluoroethoxymethyl)-4-(5-methylpyrimidin-2-yl)piperazin-1-yl]-1,3,5-triazine |
| SMILES | Cc1cnc(N2CCN(c3ncncn3)[C@@H](COCCF)C2)nc1 |
| InChI | InChI=1S/C15H20FN7O/c1-12-6-18-14(19-7-12)22-3-4-23(15-20-10-17-11-21-15)13(8-22)9-24-5-2-16/h6-7,10-11,13H,2-5,8-9H2,1H3/t13-/m1/s1 |
| InChIKey | FHKOTONVJAISSL-CYBMUJFWSA-N |
| XLogP | 0.65 |
| TPSA | 80.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|