C21H37N7O3 — CID 176556513
ethane;2-[2-[[4-(5-methylpyrimidin-2-yl)-1-(1,3,5-triazin-2-yl)piperazin-2-yl]methoxy]ethoxy]ethanol (PubChem CID 176556513) has the molecular formula C21H37N7O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is ethane;2-[2-[[4-(5-methylpyrimidin-2-yl)-1-(1,3,5-triazin-2-yl)piperazin-2-yl]methoxy]ethoxy]ethanol.
| Compound Name | ethane;2-[2-[[4-(5-methylpyrimidin-2-yl)-1-(1,3,5-triazin-2-yl)piperazin-2-yl]methoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 176556513 |
| Molecular Formula | C21H37N7O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | ethane;2-[2-[[4-(5-methylpyrimidin-2-yl)-1-(1,3,5-triazin-2-yl)piperazin-2-yl]methoxy]ethoxy]ethanol |
| SMILES | CC.CC.Cc1cnc(N2CCN(c3ncncn3)C(COCCOCCO)C2)nc1 |
| InChI | InChI=1S/C17H25N7O3.2C2H6/c1-14-8-19-16(20-9-14)23-2-3-24(17-21-12-18-13-22-17)15(10-23)11-27-7-6-26-5-4-25;2*1-2/h8-9,12-13,15,25H,2-7,10-11H2,1H3;2*1-2H3 |
| InChIKey | JQMZEBDBBRFCLI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|