C19H21Cl2N3O2 — CID 176560113
2-[1-(2,6-dichlorophenoxy)-2-(3-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole;formamide (PubChem CID 176560113) has the molecular formula C19H21Cl2N3O2 and a molecular weight of 394.30 g/mol. Its IUPAC name is 2-[1-(2,6-dichlorophenoxy)-2-(3-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole;formamide.
| Compound Name | 2-[1-(2,6-dichlorophenoxy)-2-(3-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole;formamide |
|---|---|
| PubChem CID | 176560113 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 2-[1-(2,6-dichlorophenoxy)-2-(3-methylphenyl)ethyl]-4,5-dihydro-1H-imidazole;formamide |
| SMILES | Cc1cccc(CC(Oc2c(Cl)cccc2Cl)C2=NCCN2)c1.NC=O |
| InChI | InChI=1S/C18H18Cl2N2O.CH3NO/c1-12-4-2-5-13(10-12)11-16(18-21-8-9-22-18)23-17-14(19)6-3-7-15(17)20;2-1-3/h2-7,10,16H,8-9,11H2,1H3,(H,21,22);1H,(H2,2,3) |
| InChIKey | FCAFJFOZGGXAJK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|