C56H100N2O16 — CID 176560922
tris(5-octanoyloxypentyl) 2-[3-[methyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]propanoyloxy]propane-1,2,3-tricarboxylate (PubChem CID 176560922) has the molecular formula C56H100N2O16 and a molecular weight of 1057.41 g/mol. Its IUPAC name is tris(5-octanoyloxypentyl) 2-[3-[methyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]propanoyloxy]propane-1,2,3-tricarboxylate.
| Compound Name | tris(5-octanoyloxypentyl) 2-[3-[methyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]propanoyloxy]propane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 176560922 |
| Molecular Formula | C56H100N2O16 |
| Molecular Weight | 1057.41 g/mol |
| Exact Mass | 1056.71 |
| IUPAC Name | tris(5-octanoyloxypentyl) 2-[3-[methyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]propanoyloxy]propane-1,2,3-tricarboxylate |
| SMILES | CCCCCCCC(=O)OCCCCCOC(=O)CC(CC(=O)OCCCCCOC(=O)CCCCCCC)(OC(=O)CCN(C)CCNC(=O)OC(C)(C)C)C(=O)OCCCCCOC(=O)CCCCCCC |
| InChI | InChI=1S/C56H100N2O16/c1-8-11-14-17-23-32-47(59)67-39-26-20-29-42-70-51(63)45-56(73-50(62)35-37-58(7)38-36-57-54(66)74-55(4,5)6,53(65)72-44-31-22-28-41-69-49(61)34-25-19-16-13-10-3)46-52(64)71-43-30-21-27-40-68-48(60)33-24-18-15-12-9-2/h8-46H2,1-7H3,(H,57,66) |
| InChIKey | GSIQEKLJPBFPOL-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 225.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1057.41 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|