C6H9ClN2 — CID 176561081
(E)-3-chlorohex-3-ene-2,5-diimine (PubChem CID 176561081) has the molecular formula C6H9ClN2 and a molecular weight of 144.60 g/mol. Its IUPAC name is (E)-3-chlorohex-3-ene-2,5-diimine.
| Compound Name | (E)-3-chlorohex-3-ene-2,5-diimine |
|---|---|
| PubChem CID | 176561081 |
| Molecular Formula | C6H9ClN2 |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | (E)-3-chlorohex-3-ene-2,5-diimine |
| SMILES | [H]/N=C(C)/C=C(Cl)\C(C)=N\[H] |
| InChI | InChI=1S/C6H9ClN2/c1-4(8)3-6(7)5(2)9/h3,8-9H,1-2H3/b6-3+,8-4+,9-5+ |
| InChIKey | RZWCZUBQHHVOLC-YLSAQHKZSA-N |
| XLogP | 2.19 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|