potassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine

C11H20FKN2 — CID 176562157

IUPACpotassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine
SMILESFC1CCCN(CC2CC[N-]CC2)C1.[K+]
InChIInChI=1S/C11H20FN2.K/c12-11-2-1-7-14(9-11)8-10-3-5-13-6-4-10;/h10-11H,1-9H2;/q-1;+1
InChIKeyMMMTVCSCYNTKRY-UHFFFAOYSA-N
MW238.39 g/mol
LogP-0.79
Rot. Bonds2

About potassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine

potassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine (PubChem CID 176562157) has the molecular formula C11H20FKN2 and a molecular weight of 238.39 g/mol. Its IUPAC name is potassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine.

Molecular Properties

Compound Namepotassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine
PubChem CID176562157
Molecular FormulaC11H20FKN2
Molecular Weight238.39 g/mol
Exact Mass238.12
IUPAC Namepotassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine
SMILESFC1CCCN(CC2CC[N-]CC2)C1.[K+]
InChIInChI=1S/C11H20FN2.K/c12-11-2-1-7-14(9-11)8-10-3-5-13-6-4-10;/h10-11H,1-9H2;/q-1;+1
InChIKeyMMMTVCSCYNTKRY-UHFFFAOYSA-N
XLogP-0.79
TPSA17.34 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.39
LogP ≤ 5-0.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze potassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine?
The IUPAC name of potassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine (CID 176562157) is potassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine.
What is the SMILES notation for potassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine?
The canonical SMILES for potassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine is FC1CCCN(CC2CC[N-]CC2)C1.[K+].
What is the InChIKey of potassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine?
The InChIKey is MMMTVCSCYNTKRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20FN2.K/c12-11-2-1-7-14(9-11)8-10-3-5-13-6-4-10;/h10-11H,1-9H2;/q-1;+1.
What are the key properties of potassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine?
potassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine has a molecular weight of 238.39 g/mol, XLogP of -0.79, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3-fluoro-1-(piperidin-1-id-4-ylmethyl)piperidine is sourced from PubChem (CID 176562157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).