C14H27FN2 — CID 176562259
3-fluoro-1-[(1-propan-2-ylpiperidin-4-yl)methyl]piperidine (PubChem CID 176562259) has the molecular formula C14H27FN2 and a molecular weight of 242.38 g/mol. Its IUPAC name is 3-fluoro-1-[(1-propan-2-ylpiperidin-4-yl)methyl]piperidine.
| Compound Name | 3-fluoro-1-[(1-propan-2-ylpiperidin-4-yl)methyl]piperidine |
|---|---|
| PubChem CID | 176562259 |
| Molecular Formula | C14H27FN2 |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 3-fluoro-1-[(1-propan-2-ylpiperidin-4-yl)methyl]piperidine |
| SMILES | CC(C)N1CCC(CN2CCCC(F)C2)CC1 |
| InChI | InChI=1S/C14H27FN2/c1-12(2)17-8-5-13(6-9-17)10-16-7-3-4-14(15)11-16/h12-14H,3-11H2,1-2H3 |
| InChIKey | IHVXCIBPBLVANK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |