C23H30BrFN2O2 — CID 176563493
tert-butyl 9-(5-bromo-4-fluoroindol-1-yl)-3-azaspiro[5.5]undecane-3-carboxylate (PubChem CID 176563493) has the molecular formula C23H30BrFN2O2 and a molecular weight of 465.41 g/mol. Its IUPAC name is tert-butyl 9-(5-bromo-4-fluoroindol-1-yl)-3-azaspiro[5.5]undecane-3-carboxylate.
| Compound Name | tert-butyl 9-(5-bromo-4-fluoroindol-1-yl)-3-azaspiro[5.5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 176563493 |
| Molecular Formula | C23H30BrFN2O2 |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | tert-butyl 9-(5-bromo-4-fluoroindol-1-yl)-3-azaspiro[5.5]undecane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(n3ccc4c(F)c(Br)ccc43)CC2)CC1 |
| InChI | InChI=1S/C23H30BrFN2O2/c1-22(2,3)29-21(28)26-14-11-23(12-15-26)9-6-16(7-10-23)27-13-8-17-19(27)5-4-18(24)20(17)25/h4-5,8,13,16H,6-7,9-12,14-15H2,1-3H3 |
| InChIKey | WLZREFVIJXCUFZ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |