C23H34FN7 — CID 176567132
2-amino-N'-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-4-piperazin-1-ylbenzenecarboximidamide;ethane (PubChem CID 176567132) has the molecular formula C23H34FN7 and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-amino-N'-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-4-piperazin-1-ylbenzenecarboximidamide;ethane.
| Compound Name | 2-amino-N'-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-4-piperazin-1-ylbenzenecarboximidamide;ethane |
|---|---|
| PubChem CID | 176567132 |
| Molecular Formula | C23H34FN7 |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | 2-amino-N'-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-4-piperazin-1-ylbenzenecarboximidamide;ethane |
| SMILES | CC.CC.Cc1cn2cc(/N=C(\N)c3ccc(N4CCNCC4)cc3N)cc(F)c2n1 |
| InChI | InChI=1S/C19H22FN7.2C2H6/c1-12-10-27-11-13(8-16(20)19(27)24-12)25-18(22)15-3-2-14(9-17(15)21)26-6-4-23-5-7-26;2*1-2/h2-3,8-11,23H,4-7,21H2,1H3,(H2,22,25);2*1-2H3 |
| InChIKey | NBSIVRPLJOVHSL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|