C19H22FN7 — CID 176567133
2-amino-N'-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-4-piperazin-1-ylbenzenecarboximidamide (PubChem CID 176567133) has the molecular formula C19H22FN7 and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-amino-N'-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-4-piperazin-1-ylbenzenecarboximidamide.
| Compound Name | 2-amino-N'-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-4-piperazin-1-ylbenzenecarboximidamide |
|---|---|
| PubChem CID | 176567133 |
| Molecular Formula | C19H22FN7 |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-amino-N'-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-4-piperazin-1-ylbenzenecarboximidamide |
| SMILES | Cc1cn2cc(/N=C(\N)c3ccc(N4CCNCC4)cc3N)cc(F)c2n1 |
| InChI | InChI=1S/C19H22FN7/c1-12-10-27-11-13(8-16(20)19(27)24-12)25-18(22)15-3-2-14(9-17(15)21)26-6-4-23-5-7-26/h2-3,8-11,23H,4-7,21H2,1H3,(H2,22,25) |
| InChIKey | MIIAVLMCGDWJRU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|