C9H15N3 — CID 176567437
6-imino-3-methyl-5-(methylaminomethyl)cyclohexa-1,3-dien-1-amine (PubChem CID 176567437) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 6-imino-3-methyl-5-(methylaminomethyl)cyclohexa-1,3-dien-1-amine.
| Compound Name | 6-imino-3-methyl-5-(methylaminomethyl)cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 176567437 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 6-imino-3-methyl-5-(methylaminomethyl)cyclohexa-1,3-dien-1-amine |
| SMILES | [H]/N=C1/C(N)=CC(C)=CC1CNC |
| InChI | InChI=1S/C9H15N3/c1-6-3-7(5-12-2)9(11)8(10)4-6/h3-4,7,11-12H,5,10H2,1-2H3/b11-9+ |
| InChIKey | YLJSOEIUSCRHMY-PKNBQFBNSA-N |
| XLogP | 0.64 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|