C16H20N2 — CID 176569380
5-ethyl-1-methyl-3-(1,2,3,6-tetrahydropyridin-5-yl)indole (PubChem CID 176569380) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 5-ethyl-1-methyl-3-(1,2,3,6-tetrahydropyridin-5-yl)indole.
| Compound Name | 5-ethyl-1-methyl-3-(1,2,3,6-tetrahydropyridin-5-yl)indole |
|---|---|
| PubChem CID | 176569380 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 5-ethyl-1-methyl-3-(1,2,3,6-tetrahydropyridin-5-yl)indole |
| SMILES | CCc1ccc2c(c1)c(C1=CCCNC1)cn2C |
| InChI | InChI=1S/C16H20N2/c1-3-12-6-7-16-14(9-12)15(11-18(16)2)13-5-4-8-17-10-13/h5-7,9,11,17H,3-4,8,10H2,1-2H3 |
| InChIKey | SRSWDCPUSXVIDQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |