C13H15BrN2 — CID 84642518
10-bromo-8-ethyl-1,2,3,4-tetrahydropyrazino[1,2-a]indole (PubChem CID 84642518) has the molecular formula C13H15BrN2 and a molecular weight of 279.18 g/mol. Its IUPAC name is 10-bromo-8-ethyl-1,2,3,4-tetrahydropyrazino[1,2-a]indole.
| Compound Name | 10-bromo-8-ethyl-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 84642518 |
| Molecular Formula | C13H15BrN2 |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 10-bromo-8-ethyl-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
| SMILES | CCc1ccc2c(c1)c(Br)c1n2CCNC1 |
| InChI | InChI=1S/C13H15BrN2/c1-2-9-3-4-11-10(7-9)13(14)12-8-15-5-6-16(11)12/h3-4,7,15H,2,5-6,8H2,1H3 |
| InChIKey | HPRWKJDUJVLNHB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |