C12H12N2O — CID 82397497
1,2,3,4-tetrahydropyrazino[1,2-a]indole-10-carbaldehyde (PubChem CID 82397497) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 1,2,3,4-tetrahydropyrazino[1,2-a]indole-10-carbaldehyde.
| Compound Name | 1,2,3,4-tetrahydropyrazino[1,2-a]indole-10-carbaldehyde |
|---|---|
| PubChem CID | 82397497 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 1,2,3,4-tetrahydropyrazino[1,2-a]indole-10-carbaldehyde |
| SMILES | O=Cc1c2n(c3ccccc13)CCNC2 |
| InChI | InChI=1S/C12H12N2O/c15-8-10-9-3-1-2-4-11(9)14-6-5-13-7-12(10)14/h1-4,8,13H,5-7H2 |
| InChIKey | PPDPXYWESXWSPS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|