C13H14N2O2 — CID 84740760
6-methoxy-1,2,3,4-tetrahydropyrazino[1,2-a]indole-10-carbaldehyde (PubChem CID 84740760) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 6-methoxy-1,2,3,4-tetrahydropyrazino[1,2-a]indole-10-carbaldehyde.
| Compound Name | 6-methoxy-1,2,3,4-tetrahydropyrazino[1,2-a]indole-10-carbaldehyde |
|---|---|
| PubChem CID | 84740760 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 6-methoxy-1,2,3,4-tetrahydropyrazino[1,2-a]indole-10-carbaldehyde |
| SMILES | COc1cccc2c(C=O)c3n(c12)CCNC3 |
| InChI | InChI=1S/C13H14N2O2/c1-17-12-4-2-3-9-10(8-16)11-7-14-5-6-15(11)13(9)12/h2-4,8,14H,5-7H2,1H3 |
| InChIKey | INYBYNABXZERNJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|