C16H22N2 — CID 84630615
6-ethyl-10-propan-2-yl-1,2,3,4-tetrahydropyrazino[1,2-a]indole (PubChem CID 84630615) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 6-ethyl-10-propan-2-yl-1,2,3,4-tetrahydropyrazino[1,2-a]indole.
| Compound Name | 6-ethyl-10-propan-2-yl-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 84630615 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 6-ethyl-10-propan-2-yl-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
| SMILES | CCc1cccc2c(C(C)C)c3n(c12)CCNC3 |
| InChI | InChI=1S/C16H22N2/c1-4-12-6-5-7-13-15(11(2)3)14-10-17-8-9-18(14)16(12)13/h5-7,11,17H,4,8-10H2,1-3H3 |
| InChIKey | GSRRMXZYAOUJKB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|