C12H15N3 — CID 84619763
6-ethyl-1,2,3,4-tetrahydropyrazino[1,2-a]benzimidazole (PubChem CID 84619763) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 6-ethyl-1,2,3,4-tetrahydropyrazino[1,2-a]benzimidazole.
| Compound Name | 6-ethyl-1,2,3,4-tetrahydropyrazino[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 84619763 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 6-ethyl-1,2,3,4-tetrahydropyrazino[1,2-a]benzimidazole |
| SMILES | CCc1cccc2nc3n(c12)CCNC3 |
| InChI | InChI=1S/C12H15N3/c1-2-9-4-3-5-10-12(9)15-7-6-13-8-11(15)14-10/h3-5,13H,2,6-8H2,1H3 |
| InChIKey | FJHMKYSSCFNPAR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |