C13H13ClN2O2 — CID 84742781
2-(6-chloro-1,2,3,4-tetrahydropyrazino[1,2-a]indol-10-yl)acetic acid (PubChem CID 84742781) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is 2-(6-chloro-1,2,3,4-tetrahydropyrazino[1,2-a]indol-10-yl)acetic acid.
| Compound Name | 2-(6-chloro-1,2,3,4-tetrahydropyrazino[1,2-a]indol-10-yl)acetic acid |
|---|---|
| PubChem CID | 84742781 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-(6-chloro-1,2,3,4-tetrahydropyrazino[1,2-a]indol-10-yl)acetic acid |
| SMILES | O=C(O)Cc1c2n(c3c(Cl)cccc13)CCNC2 |
| InChI | InChI=1S/C13H13ClN2O2/c14-10-3-1-2-8-9(6-12(17)18)11-7-15-4-5-16(11)13(8)10/h1-3,15H,4-7H2,(H,17,18) |
| InChIKey | ZXPQVTLEDRCMMM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|