C13H16N2O2 — CID 96598907
8,9-dimethoxy-1,2,3,4-tetrahydropyrazino[1,2-a]indole (PubChem CID 96598907) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 8,9-dimethoxy-1,2,3,4-tetrahydropyrazino[1,2-a]indole.
| Compound Name | 8,9-dimethoxy-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 96598907 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 8,9-dimethoxy-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
| SMILES | COc1ccc2c(cc3n2CCNC3)c1OC |
| InChI | InChI=1S/C13H16N2O2/c1-16-12-4-3-11-10(13(12)17-2)7-9-8-14-5-6-15(9)11/h3-4,7,14H,5-6,8H2,1-2H3 |
| InChIKey | TVMRHWJYXKAFFO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 35.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |