C12H13ClN2O — CID 96594157
9-chloro-8-methoxy-1,2,3,4-tetrahydropyrazino[1,2-a]indole (PubChem CID 96594157) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 9-chloro-8-methoxy-1,2,3,4-tetrahydropyrazino[1,2-a]indole.
| Compound Name | 9-chloro-8-methoxy-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 96594157 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 9-chloro-8-methoxy-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
| SMILES | COc1ccc2c(cc3n2CCNC3)c1Cl |
| InChI | InChI=1S/C12H13ClN2O/c1-16-11-3-2-10-9(12(11)13)6-8-7-14-4-5-15(8)10/h2-3,6,14H,4-5,7H2,1H3 |
| InChIKey | PDDYMPUZOSFFSJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |