C12H13FN2 — CID 84620202
7-fluoro-10-methyl-1,2,3,4-tetrahydropyrazino[1,2-a]indole (PubChem CID 84620202) has the molecular formula C12H13FN2 and a molecular weight of 204.25 g/mol. Its IUPAC name is 7-fluoro-10-methyl-1,2,3,4-tetrahydropyrazino[1,2-a]indole.
| Compound Name | 7-fluoro-10-methyl-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 84620202 |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 7-fluoro-10-methyl-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
| SMILES | Cc1c2n(c3cc(F)ccc13)CCNC2 |
| InChI | InChI=1S/C12H13FN2/c1-8-10-3-2-9(13)6-11(10)15-5-4-14-7-12(8)15/h2-3,6,14H,4-5,7H2,1H3 |
| InChIKey | QUGYLQRQCHYMIP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|