C14H18N2 — CID 84622037
6,9,10-trimethyl-1,2,3,4-tetrahydropyrazino[1,2-a]indole (PubChem CID 84622037) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 6,9,10-trimethyl-1,2,3,4-tetrahydropyrazino[1,2-a]indole.
| Compound Name | 6,9,10-trimethyl-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 84622037 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 6,9,10-trimethyl-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
| SMILES | Cc1ccc(C)c2c1c(C)c1n2CCNC1 |
| InChI | InChI=1S/C14H18N2/c1-9-4-5-10(2)14-13(9)11(3)12-8-15-6-7-16(12)14/h4-5,15H,6-8H2,1-3H3 |
| InChIKey | VXIBBMLLWXBYCQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |