About 6,8-dimethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine
6,8-dimethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine (PubChem CID 84649460) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 6,8-dimethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine.
Analyze 6,8-dimethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dimethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine?
The IUPAC name of 6,8-dimethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine (CID 84649460) is 6,8-dimethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine.
What is the SMILES notation for 6,8-dimethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine?
The canonical SMILES for 6,8-dimethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine is Cc1cc(C)n2c1CNCC2.
What is the InChIKey of 6,8-dimethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine?
The InChIKey is LPEVGLYFLBKRMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-7-5-8(2)11-4-3-10-6-9(7)11/h5,10H,3-4,6H2,1-2H3.
What are the key properties of 6,8-dimethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine?
6,8-dimethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine has a molecular weight of 150.22 g/mol, XLogP of 1.21, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dimethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine is sourced from PubChem (CID 84649460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).