C37H78N4O2 — CID 176570849
2-[2-[di(nonyl)amino]ethyl-nonylamino]-N-[2-(hydroxymethylamino)ethyl]-N-propylacetamide (PubChem CID 176570849) has the molecular formula C37H78N4O2 and a molecular weight of 611.06 g/mol. Its IUPAC name is 2-[2-[di(nonyl)amino]ethyl-nonylamino]-N-[2-(hydroxymethylamino)ethyl]-N-propylacetamide.
| Compound Name | 2-[2-[di(nonyl)amino]ethyl-nonylamino]-N-[2-(hydroxymethylamino)ethyl]-N-propylacetamide |
|---|---|
| PubChem CID | 176570849 |
| Molecular Formula | C37H78N4O2 |
| Molecular Weight | 611.06 g/mol |
| Exact Mass | 610.61 |
| IUPAC Name | 2-[2-[di(nonyl)amino]ethyl-nonylamino]-N-[2-(hydroxymethylamino)ethyl]-N-propylacetamide |
| SMILES | CCCCCCCCCN(CCCCCCCCC)CCN(CCCCCCCCC)CC(=O)N(CCC)CCNCO |
| InChI | InChI=1S/C37H78N4O2/c1-5-9-12-15-18-21-24-29-39(30-25-22-19-16-13-10-6-2)33-34-40(31-26-23-20-17-14-11-7-3)35-37(43)41(28-8-4)32-27-38-36-42/h38,42H,5-36H2,1-4H3 |
| InChIKey | HUMMKZSVZGKRTL-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.06 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|