C51H106N6O2 — CID 168924630
2-[2-[di(nonyl)amino]ethyl-nonylamino]-N-(2-formamidoethyl)-N-[3-[[2-methyl-3-(methylamino)propyl]-nonylamino]propyl]acetamide (PubChem CID 168924630) has the molecular formula C51H106N6O2 and a molecular weight of 835.45 g/mol. Its IUPAC name is 2-[2-[di(nonyl)amino]ethyl-nonylamino]-N-(2-formamidoethyl)-N-[3-[[2-methyl-3-(methylamino)propyl]-nonylamino]propyl]acetamide.
| Compound Name | 2-[2-[di(nonyl)amino]ethyl-nonylamino]-N-(2-formamidoethyl)-N-[3-[[2-methyl-3-(methylamino)propyl]-nonylamino]propyl]acetamide |
|---|---|
| PubChem CID | 168924630 |
| Molecular Formula | C51H106N6O2 |
| Molecular Weight | 835.45 g/mol |
| Exact Mass | 834.84 |
| IUPAC Name | 2-[2-[di(nonyl)amino]ethyl-nonylamino]-N-(2-formamidoethyl)-N-[3-[[2-methyl-3-(methylamino)propyl]-nonylamino]propyl]acetamide |
| SMILES | CCCCCCCCCN(CCCCCCCCC)CCN(CCCCCCCCC)CC(=O)N(CCCN(CCCCCCCCC)CC(C)CNC)CCNC=O |
| InChI | InChI=1S/C51H106N6O2/c1-7-11-15-19-23-27-31-37-54(38-32-28-24-20-16-12-8-2)44-45-56(40-34-30-26-22-18-14-10-4)48-51(59)57(43-36-53-49-58)42-35-41-55(47-50(5)46-52-6)39-33-29-25-21-17-13-9-3/h49-50,52H,7-48H2,1-6H3,(H,53,58) |
| InChIKey | OJLWATOFTUQJLN-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.45 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|