C15H12F3NO — CID 176571999
4-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-isoindol-1-ol (PubChem CID 176571999) has the molecular formula C15H12F3NO and a molecular weight of 279.26 g/mol. Its IUPAC name is 4-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-isoindol-1-ol.
| Compound Name | 4-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-isoindol-1-ol |
|---|---|
| PubChem CID | 176571999 |
| Molecular Formula | C15H12F3NO |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 4-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-isoindol-1-ol |
| SMILES | OC1NCc2c(-c3ccc(C(F)(F)F)cc3)cccc21 |
| InChI | InChI=1S/C15H12F3NO/c16-15(17,18)10-6-4-9(5-7-10)11-2-1-3-12-13(11)8-19-14(12)20/h1-7,14,19-20H,8H2 |
| InChIKey | MTGWXKRCABVXCZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |