C15H10F3NO — CID 15315314
7-[4-(trifluoromethyl)phenyl]-2,3-dihydroisoindol-1-one (PubChem CID 15315314) has the molecular formula C15H10F3NO and a molecular weight of 277.25 g/mol. Its IUPAC name is 7-[4-(trifluoromethyl)phenyl]-2,3-dihydroisoindol-1-one.
| Compound Name | 7-[4-(trifluoromethyl)phenyl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 15315314 |
| Molecular Formula | C15H10F3NO |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 7-[4-(trifluoromethyl)phenyl]-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2cccc(-c3ccc(C(F)(F)F)cc3)c21 |
| InChI | InChI=1S/C15H10F3NO/c16-15(17,18)11-6-4-9(5-7-11)12-3-1-2-10-8-19-14(20)13(10)12/h1-7H,8H2,(H,19,20) |
| InChIKey | JIKJOYBXVVEWED-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |