C16H13F3N2 — CID 163520117
3-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1H-2,4-benzodiazepine (PubChem CID 163520117) has the molecular formula C16H13F3N2 and a molecular weight of 290.29 g/mol. Its IUPAC name is 3-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1H-2,4-benzodiazepine.
| Compound Name | 3-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1H-2,4-benzodiazepine |
|---|---|
| PubChem CID | 163520117 |
| Molecular Formula | C16H13F3N2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 3-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1H-2,4-benzodiazepine |
| SMILES | FC(F)(F)c1ccc(C2=NCc3ccccc3CN2)cc1 |
| InChI | InChI=1S/C16H13F3N2/c17-16(18,19)14-7-5-11(6-8-14)15-20-9-12-3-1-2-4-13(12)10-21-15/h1-8H,9-10H2,(H,20,21) |
| InChIKey | DKBUVZAISBXDJO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |