C27H24ClNO8 — CID 176572661
2-chloro-5-[3-[[1-oxo-2-(2,2,5,5-tetrahydroxycyclopentyl)-3H-isoindol-5-yl]oxymethyl]phenyl]benzoic acid (PubChem CID 176572661) has the molecular formula C27H24ClNO8 and a molecular weight of 525.94 g/mol. Its IUPAC name is 2-chloro-5-[3-[[1-oxo-2-(2,2,5,5-tetrahydroxycyclopentyl)-3H-isoindol-5-yl]oxymethyl]phenyl]benzoic acid.
| Compound Name | 2-chloro-5-[3-[[1-oxo-2-(2,2,5,5-tetrahydroxycyclopentyl)-3H-isoindol-5-yl]oxymethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 176572661 |
| Molecular Formula | C27H24ClNO8 |
| Molecular Weight | 525.94 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 2-chloro-5-[3-[[1-oxo-2-(2,2,5,5-tetrahydroxycyclopentyl)-3H-isoindol-5-yl]oxymethyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1cc(-c2cccc(COc3ccc4c(c3)CN(C3C(O)(O)CCC3(O)O)C4=O)c2)ccc1Cl |
| InChI | InChI=1S/C27H24ClNO8/c28-22-7-4-17(12-21(22)24(31)32)16-3-1-2-15(10-16)14-37-19-5-6-20-18(11-19)13-29(23(20)30)25-26(33,34)8-9-27(25,35)36/h1-7,10-12,25,33-36H,8-9,13-14H2,(H,31,32) |
| InChIKey | MYQIMSIKWVANDU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 147.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.94 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|