C26H24ClNO7 — CID 176572679
2-chloro-5-[3-[[1-oxo-2-(2,2,4-trihydroxybutyl)-3H-isoindol-5-yl]oxymethyl]phenyl]benzoic acid (PubChem CID 176572679) has the molecular formula C26H24ClNO7 and a molecular weight of 497.93 g/mol. Its IUPAC name is 2-chloro-5-[3-[[1-oxo-2-(2,2,4-trihydroxybutyl)-3H-isoindol-5-yl]oxymethyl]phenyl]benzoic acid.
| Compound Name | 2-chloro-5-[3-[[1-oxo-2-(2,2,4-trihydroxybutyl)-3H-isoindol-5-yl]oxymethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 176572679 |
| Molecular Formula | C26H24ClNO7 |
| Molecular Weight | 497.93 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 2-chloro-5-[3-[[1-oxo-2-(2,2,4-trihydroxybutyl)-3H-isoindol-5-yl]oxymethyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1cc(-c2cccc(COc3ccc4c(c3)CN(CC(O)(O)CCO)C4=O)c2)ccc1Cl |
| InChI | InChI=1S/C26H24ClNO7/c27-23-7-4-18(12-22(23)25(31)32)17-3-1-2-16(10-17)14-35-20-5-6-21-19(11-20)13-28(24(21)30)15-26(33,34)8-9-29/h1-7,10-12,29,33-34H,8-9,13-15H2,(H,31,32) |
| InChIKey | OPGKGKNTUXANHX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.93 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|