C31H44N4O6S — CID 176573095
tert-butyl N-[(2S)-3,3-dimethyl-1-[(2S,4R)-4-[(2-methylpropan-2-yl)oxy]-2-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methylcarbamoyl]pyrrolidin-1-yl]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 176573095) has the molecular formula C31H44N4O6S and a molecular weight of 600.78 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3,3-dimethyl-1-[(2S,4R)-4-[(2-methylpropan-2-yl)oxy]-2-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methylcarbamoyl]pyrrolidin-1-yl]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3,3-dimethyl-1-[(2S,4R)-4-[(2-methylpropan-2-yl)oxy]-2-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methylcarbamoyl]pyrrolidin-1-yl]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 176573095 |
| Molecular Formula | C31H44N4O6S |
| Molecular Weight | 600.78 g/mol |
| Exact Mass | 600.30 |
| IUPAC Name | tert-butyl N-[(2S)-3,3-dimethyl-1-[(2S,4R)-4-[(2-methylpropan-2-yl)oxy]-2-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methylcarbamoyl]pyrrolidin-1-yl]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)[C@@H]2C[C@@H](OC(C)(C)C)CN2C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C=O)cc1 |
| InChI | InChI=1S/C31H44N4O6S/c1-19-24(42-18-33-19)21-12-10-20(11-13-21)15-32-26(37)23-14-22(40-29(2,3)4)16-35(23)27(38)25(31(8,9)17-36)34-28(39)41-30(5,6)7/h10-13,17-18,22-23,25H,14-16H2,1-9H3,(H,32,37)(H,34,39)/t22-,23+,25-/m1/s1 |
| InChIKey | WLIIFFHYNUDNIU-GIFXNVAJSA-N |
| XLogP | 4.64 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.78 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|