C19H20ClFN4O — CID 176574594
(3S)-1-[2-[(4-chloro-3-fluoro-1H-indol-6-yl)amino]-3-methyl-4-pyridinyl]piperidin-3-ol (PubChem CID 176574594) has the molecular formula C19H20ClFN4O and a molecular weight of 374.85 g/mol. Its IUPAC name is (3S)-1-[2-[(4-chloro-3-fluoro-1H-indol-6-yl)amino]-3-methyl-4-pyridinyl]piperidin-3-ol.
| Compound Name | (3S)-1-[2-[(4-chloro-3-fluoro-1H-indol-6-yl)amino]-3-methyl-4-pyridinyl]piperidin-3-ol |
|---|---|
| PubChem CID | 176574594 |
| Molecular Formula | C19H20ClFN4O |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (3S)-1-[2-[(4-chloro-3-fluoro-1H-indol-6-yl)amino]-3-methyl-4-pyridinyl]piperidin-3-ol |
| SMILES | Cc1c(N2CCC[C@H](O)C2)ccnc1Nc1cc(Cl)c2c(F)c[nH]c2c1 |
| InChI | InChI=1S/C19H20ClFN4O/c1-11-17(25-6-2-3-13(26)10-25)4-5-22-19(11)24-12-7-14(20)18-15(21)9-23-16(18)8-12/h4-5,7-9,13,23,26H,2-3,6,10H2,1H3,(H,22,24)/t13-/m0/s1 |
| InChIKey | JKIULSWJCHLSTC-ZDUSSCGKSA-N |
| XLogP | 4.37 |
| TPSA | 64.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |