C19H24ClFN6O — CID 177317957
1-[6-[(5-chloro-4-fluoro-2-pyridinyl)amino]-4-piperazin-1-yl-2-pyridinyl]piperidin-3-ol (PubChem CID 177317957) has the molecular formula C19H24ClFN6O and a molecular weight of 406.89 g/mol. Its IUPAC name is 1-[6-[(5-chloro-4-fluoro-2-pyridinyl)amino]-4-piperazin-1-yl-2-pyridinyl]piperidin-3-ol.
| Compound Name | 1-[6-[(5-chloro-4-fluoro-2-pyridinyl)amino]-4-piperazin-1-yl-2-pyridinyl]piperidin-3-ol |
|---|---|
| PubChem CID | 177317957 |
| Molecular Formula | C19H24ClFN6O |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 1-[6-[(5-chloro-4-fluoro-2-pyridinyl)amino]-4-piperazin-1-yl-2-pyridinyl]piperidin-3-ol |
| SMILES | OC1CCCN(c2cc(N3CCNCC3)cc(Nc3cc(F)c(Cl)cn3)n2)C1 |
| InChI | InChI=1S/C19H24ClFN6O/c20-15-11-23-17(10-16(15)21)24-18-8-13(26-6-3-22-4-7-26)9-19(25-18)27-5-1-2-14(28)12-27/h8-11,14,22,28H,1-7,12H2,(H,23,24,25) |
| InChIKey | LNBMWXGVLHKLFT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |