C9H10ClNO3S — CID 176577581
(4S)-4-(4-chlorophenyl)oxathiazinane 2,2-dioxide (PubChem CID 176577581) has the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. Its IUPAC name is (4S)-4-(4-chlorophenyl)oxathiazinane 2,2-dioxide.
| Compound Name | (4S)-4-(4-chlorophenyl)oxathiazinane 2,2-dioxide |
|---|---|
| PubChem CID | 176577581 |
| Molecular Formula | C9H10ClNO3S |
| Molecular Weight | 247.70 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | (4S)-4-(4-chlorophenyl)oxathiazinane 2,2-dioxide |
| SMILES | O=S1(=O)N[C@H](c2ccc(Cl)cc2)CCO1 |
| InChI | InChI=1S/C9H10ClNO3S/c10-8-3-1-7(2-4-8)9-5-6-14-15(12,13)11-9/h1-4,9,11H,5-6H2/t9-/m0/s1 |
| InChIKey | GFJVWGZOFGVVKP-VIFPVBQESA-N |
| XLogP | 1.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.70 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |