C11H12ClN3O2S — CID 135760770
4-(4-chlorophenyl)-N-cyclopropyl-1,1-dioxo-1,2,5-thiadiazolidin-3-imine (PubChem CID 135760770) has the molecular formula C11H12ClN3O2S and a molecular weight of 285.76 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-cyclopropyl-1,1-dioxo-1,2,5-thiadiazolidin-3-imine.
| Compound Name | 4-(4-chlorophenyl)-N-cyclopropyl-1,1-dioxo-1,2,5-thiadiazolidin-3-imine |
|---|---|
| PubChem CID | 135760770 |
| Molecular Formula | C11H12ClN3O2S |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 4-(4-chlorophenyl)-N-cyclopropyl-1,1-dioxo-1,2,5-thiadiazolidin-3-imine |
| SMILES | O=S1(=O)N/C(=N\C2CC2)C(c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C11H12ClN3O2S/c12-8-3-1-7(2-4-8)10-11(13-9-5-6-9)15-18(16,17)14-10/h1-4,9-10,14H,5-6H2,(H,13,15) |
| InChIKey | LWXJLRVWPZJFAG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|