C9H7ClN2O3 — CID 125493950
(5R)-5-(4-chlorophenyl)-3-hydroxyimidazolidine-2,4-dione (PubChem CID 125493950) has the molecular formula C9H7ClN2O3 and a molecular weight of 226.62 g/mol. Its IUPAC name is (5R)-5-(4-chlorophenyl)-3-hydroxyimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(4-chlorophenyl)-3-hydroxyimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 125493950 |
| Molecular Formula | C9H7ClN2O3 |
| Molecular Weight | 226.62 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | (5R)-5-(4-chlorophenyl)-3-hydroxyimidazolidine-2,4-dione |
| SMILES | O=C1N[C@H](c2ccc(Cl)cc2)C(=O)N1O |
| InChI | InChI=1S/C9H7ClN2O3/c10-6-3-1-5(2-4-6)7-8(13)12(15)9(14)11-7/h1-4,7,15H,(H,11,14)/t7-/m1/s1 |
| InChIKey | LEGWWVZUIAJBAV-SSDOTTSWSA-N |
| XLogP | 1.32 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.62 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|