C15H17N3O2S2 — CID 176578096
2-[2-methyl-6-[3-(propan-2-ylamino)prop-1-ynyl]thieno[2,3-d]pyrimidin-4-yl]sulfanylacetic acid (PubChem CID 176578096) has the molecular formula C15H17N3O2S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[2-methyl-6-[3-(propan-2-ylamino)prop-1-ynyl]thieno[2,3-d]pyrimidin-4-yl]sulfanylacetic acid.
| Compound Name | 2-[2-methyl-6-[3-(propan-2-ylamino)prop-1-ynyl]thieno[2,3-d]pyrimidin-4-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 176578096 |
| Molecular Formula | C15H17N3O2S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 2-[2-methyl-6-[3-(propan-2-ylamino)prop-1-ynyl]thieno[2,3-d]pyrimidin-4-yl]sulfanylacetic acid |
| SMILES | Cc1nc(SCC(=O)O)c2cc(C#CCNC(C)C)sc2n1 |
| InChI | InChI=1S/C15H17N3O2S2/c1-9(2)16-6-4-5-11-7-12-14(21-8-13(19)20)17-10(3)18-15(12)22-11/h7,9,16H,6,8H2,1-3H3,(H,19,20) |
| InChIKey | BDGYUIVVPNZFQF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|