C17H28N2 — CID 176578306
ethane;N-[(2Z,4E,6Z)-7-ethylnona-2,4,6,8-tetraen-4-yl]-N-[(Z)-prop-1-enyl]methanimidamide (PubChem CID 176578306) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is ethane;N-[(2Z,4E,6Z)-7-ethylnona-2,4,6,8-tetraen-4-yl]-N-[(Z)-prop-1-enyl]methanimidamide.
| Compound Name | ethane;N-[(2Z,4E,6Z)-7-ethylnona-2,4,6,8-tetraen-4-yl]-N-[(Z)-prop-1-enyl]methanimidamide |
|---|---|
| PubChem CID | 176578306 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | ethane;N-[(2Z,4E,6Z)-7-ethylnona-2,4,6,8-tetraen-4-yl]-N-[(Z)-prop-1-enyl]methanimidamide |
| SMILES | CC.[H]/N=C/N(/C=C\C)C(/C=C\C)=C/C=C(\C=C)CC |
| InChI | InChI=1S/C15H22N2.C2H6/c1-5-9-15(17(13-16)12-6-2)11-10-14(7-3)8-4;1-2/h5-7,9-13,16H,3,8H2,1-2,4H3;1-2H3/b9-5-,12-6-,14-10+,15-11+,16-13+; |
| InChIKey | HWVROQPHBFGOGC-DUUFZYEWSA-N |
| XLogP | 5.44 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|