C11H18N2 — CID 123701301
N-ethyl-N-octa-1,3,6-trien-2-ylmethanimidamide (PubChem CID 123701301) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N-ethyl-N-octa-1,3,6-trien-2-ylmethanimidamide.
| Compound Name | N-ethyl-N-octa-1,3,6-trien-2-ylmethanimidamide |
|---|---|
| PubChem CID | 123701301 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N-ethyl-N-octa-1,3,6-trien-2-ylmethanimidamide |
| SMILES | [H]/N=C/N(CC)C(=C)C=CCC=CC |
| InChI | InChI=1S/C11H18N2/c1-4-6-7-8-9-11(3)13(5-2)10-12/h4,6,8-10,12H,3,5,7H2,1-2H3/b6-4?,9-8?,12-10+ |
| InChIKey | MYNWAXYNPXLOGQ-KTJPLGNZSA-N |
| XLogP | 2.95 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|