C22H49N5O — CID 176578435
ethane;2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-N-[2-(propan-2-ylamino)ethyl]acetamide (PubChem CID 176578435) has the molecular formula C22H49N5O and a molecular weight of 399.67 g/mol. Its IUPAC name is ethane;2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-N-[2-(propan-2-ylamino)ethyl]acetamide.
| Compound Name | ethane;2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-N-[2-(propan-2-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 176578435 |
| Molecular Formula | C22H49N5O |
| Molecular Weight | 399.67 g/mol |
| Exact Mass | 399.39 |
| IUPAC Name | ethane;2-[4-[(1-methylpiperidin-4-yl)methyl]piperazin-1-yl]-N-[2-(propan-2-ylamino)ethyl]acetamide |
| SMILES | CC.CC.CC(C)NCCNC(=O)CN1CCN(CC2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C18H37N5O.2C2H6/c1-16(2)19-6-7-20-18(24)15-23-12-10-22(11-13-23)14-17-4-8-21(3)9-5-17;2*1-2/h16-17,19H,4-15H2,1-3H3,(H,20,24);2*1-2H3 |
| InChIKey | YIKJKGPTZLMRNP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.67 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|